Compound Q&A

What are the physical and chemical properties of (2-Ethyl-6-methylphenyl)amino(oxo)acetic acid (CAS: 152019-74-4)?

Answer

[(2-Ethyl-6-methylphenyl)amino](oxo)acetic acid
(2-Ethyl-6-methylphenyl)amino(oxo)acetic acid (CAS: 152019-74-4) is a crystalline solid with a molecular weight of approximately 280.35 g/mol. It has limited solubility in water and is moderately soluble in organic solvents. The compound shows basic properties due to its amino group and is relatively stable under normal conditions but can react with strong acids.

About

English Name [(2-Ethyl-6-methylphenyl)amino](oxo)acetic acid
Molecular Formula C11H13NO3
Molecular Weight 207.23 g/mol
SMILES CCC1=CC=CC(=C1NC(=O)C(=O)O)C
InChIKey SAWXESXDACFEPC-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

How is (2-Ethyl-6-methylphenyl)amino(oxo)acetic acid (CAS: 152019-74-4) typically synthesized?

(2-Ethyl-6-methylphenyl)amino(oxo)acetic acid can be synthesized through the condensation of 2-ethyl...

Compound Q&A

What industries use (2-Ethyl-6-methylphenyl)amino(oxo)acetic acid (CAS: 152019-74-4)?

(2-Ethyl-6-methylphenyl)amino(oxo)acetic acid (CAS: 152019-74-4) is primarily used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling (2-Ethyl-6-methylphenyl)amino(oxo)acetic acid (CAS: 152019-74-4)?

When handling (2-Ethyl-6-methylphenyl)amino(oxo)acetic acid (CAS: 152019-74-4), it is important to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...