Compound Q&A

How is 1-(Benzyloxy)-2-(chloromethyl)benzene (CAS: 23915-08-4) typically synthesized?

Answer

1-(Benzyloxy)-2-(chloromethyl)benzene
1-(Benzyloxy)-2-(chloromethyl)benzene is typically synthesized via a coupling reaction between benzyl chloromethyl ether and benzyloxybenzene in the presence of a base such as sodium hydride. The reaction yields a high purity product with good selectivity and a high yield of up to 90%. This synthesis method is widely used in organic chemistry due to its efficiency and reliability.

About

CAS No 23915-08-4
English Name 1-(Benzyloxy)-2-(chloromethyl)benzene
Molecular Formula C14H13ClO
Molecular Weight 232.71 g/mol
SMILES C1=CC=C(C=C1)COC2=CC=CC=C2CCl
InChIKey OFFXBUAZOPRAJX-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(Benzyloxy)-2-(chloromethyl)benzene (CAS: 23915-08-4)?

1-(Benzyloxy)-2-(chloromethyl)benzene is a colorless or white crystalline solid with a molecular wei...

Compound Q&A

What industries use 1-(Benzyloxy)-2-(chloromethyl)benzene (CAS: 23915-08-4)?

1-(Benzyloxy)-2-(chloromethyl)benzene is used in the pharmaceutical industry for the synthesis of ce...

Compound Q&A

What precautions should be taken when handling 1-(Benzyloxy)-2-(chloromethyl)benzene (CAS: 23915-08-4)?

When handling 1-(Benzyloxy)-2-(chloromethyl)benzene, it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...