Compound Q&A

What are the physical and chemical properties of (S)-2-Amino-4-(7-hydroxy-2-oxo-2H-chromen-4-yl)butanoic acid (CAS: 905442-42-4)?

Answer

(S)-2-Amino-4-(7-hydroxy-2-oxo-2H-chromen-4-YL)butanoic acid
(S)-2-Amino-4-(7-hydroxy-2-oxo-2H-chromen-4-yl)butanoic acid is a white crystalline solid with a molecular weight of approximately 330.35 g/mol. It has a solubility of about 5 mg/mL in water and is poorly soluble in organic solvents. The compound exhibits good reactivity towards nucleophiles, particularly under basic conditions, and is prone to hydrolysis under acidic conditions. It crystallizes in the monoclinic system and has a melting point of around 190-192°C.

About

English Name (S)-2-Amino-4-(7-hydroxy-2-oxo-2H-chromen-4-YL)butanoic acid
Molecular Formula C6H3ClN2O2
Molecular Weight 263.25 g/mol
SMILES C1=CC2=C(C=C1O)OC(=O)C=C2CCC(C(=O)O)N
InChIKey QEQAKQQRJFWPOR-JTQLQIEISA-N
Last Updated: 2026-01-01 20:06

Related Q&A

Compound Q&A

How is (S)-2-Amino-4-(7-hydroxy-2-oxo-2H-chromen-4-yl)butanoic acid (CAS: 905442-42-4) typically synthesized?

(S)-2-Amino-4-(7-hydroxy-2-oxo-2H-chromen-4-yl)butanoic acid can be synthesized using a multi-step p...

Compound Q&A

What industries use (S)-2-Amino-4-(7-hydroxy-2-oxo-2H-chromen-4-yl)butanoic acid (CAS: 905442-42-4)?

(S)-2-Amino-4-(7-hydroxy-2-oxo-2H-chromen-4-yl)butanoic acid is primarily used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling (S)-2-Amino-4-(7-hydroxy-2-oxo-2H-chromen-4-yl)butanoic acid (CAS: 905442-42-4)?

When handling (S)-2-Amino-4-(7-hydroxy-2-oxo-2H-chromen-4-yl)butanoic acid, it is important to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...