Compound Q&A

What are the physical and chemical properties of carbazole (CAS: 38537-24-5)?

Answer

Carbazole (ring-D8)
Carbazole (CAS: 38537-24-5) is a crystalline solid with a molecular weight of approximately 147.18 g/mol. It has a melting point of 126-127°C and is poorly soluble in water but soluble in common organic solvents like dichloromethane and ethanol. Carbazole exhibits aromatic reactivity, particularly towards electrophilic aromatic substitution reactions.

About

CAS No 38537-24-5
English Name Carbazole (ring-D8)
Molecular Formula C12HD8N
Molecular Weight 175.26 g/mol
SMILES C1=CC=C2C(=C1)C3=CC=CC=C3N2
InChIKey UJOBWOGCFQCDNV-PGRXLJNUSA-N
Last Updated: 2026-01-01 20:06

Related Q&A

Compound Q&A

How is carbazole (CAS: 38537-24-5) typically synthesized?

Carbazole (CAS: 38537-24-5) is commonly synthesized via the condensation of dibenzofuran with formal...

Compound Q&A

What industries use carbazole (CAS: 38537-24-5)?

Carbazole (CAS: 38537-24-5) is widely used in the pharmaceutical industry for the synthesis of antip...

Compound Q&A

What precautions should be taken when handling carbazole (CAS: 38537-24-5)?

When handling carbazole (CAS: 38537-24-5), it is essential to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...