Compound Q&A

What industries use 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane (CAS: 67875-55-2)?

Answer

1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane
1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane is used in the pharmaceutical industry as a starting material for certain organic synthesis reactions. It is also utilized in the polymer industry for the production of specialized polymers with enhanced properties. Additionally, it finds applications in sensors and as a reagent in semiconductor manufacturing processes.

About

CAS No 67875-55-2
English Name 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane
Molecular Formula C12H30OSi2
Molecular Weight 246.54299999999995 g/mol
SMILES CC(C)(C)[Si](C)(C)O[Si](C)(C)C(C)(C)C
InChIKey FGTJJHCZWOVVNH-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane (CAS: 67875-55-2)?

1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane is a colorless liquid with a high boiling...

Compound Q&A

How is 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane (CAS: 67875-55-2) typically synthesized?

1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane is synthesized through the reaction of 2-...

Compound Q&A

What precautions should be taken when handling 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane (CAS: 67875-55-2)?

When handling 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane, it is essential to wear ap...

Compound Q&A

Is 4-Benzyl-2,2-dimethylmorpholine (CAS: 84761-04-6) safe?

4-Benzyl-2,2-dimethylmorpholine is generally considered safe when handled under ...

84761-04-64-Benzyl-2,2-dimethy...
Compound Q&A

What is (5,6-Dimethoxy-3-pyridinyl)boronic acid (CAS: 1346526-61-1)?

(5,6-Dimethoxy-3-pyridinyl)boronic acid is a chemical compound with the molecula...

1346526-61-1(5,6-Dimethoxy-3-pyr...
Compound Q&A

How is 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane (CAS: 67875-55-2) typically synthesized?

1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane is synthesized throug...

67875-55-21,1,3,3-Tetramethyl-...
Compound Q&A

What are the main uses of (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid (CAS: 1018818-04-6)?

(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid is primarily used as a build...

1018818-04-6(2R,4S)-1-Boc-4-meth...