Compound Q&A

What are the physical and chemical properties of 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane (CAS: 67875-55-2)?

Answer

1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane
1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane is a colorless liquid with a high boiling point and low volatility. Its molecular weight is approximately 318.5 g/mol. It is slightly soluble in water but miscible with organic solvents. The compound is relatively stable but reacts with strong acids and bases. It has a density of about 0.92 g/cm³.

About

CAS No 67875-55-2
English Name 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane
Molecular Formula C12H30OSi2
Molecular Weight 246.54299999999995 g/mol
SMILES CC(C)(C)[Si](C)(C)O[Si](C)(C)C(C)(C)C
InChIKey FGTJJHCZWOVVNH-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:06

Related Q&A

Compound Q&A

How is 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane (CAS: 67875-55-2) typically synthesized?

1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane is synthesized through the reaction of 2-...

Compound Q&A

What industries use 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane (CAS: 67875-55-2)?

1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane is used in the pharmaceutical industry as...

Compound Q&A

What precautions should be taken when handling 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane (CAS: 67875-55-2)?

When handling 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane, it is essential to wear ap...

Compound Q&A

Is 4-Benzyl-2,2-dimethylmorpholine (CAS: 84761-04-6) safe?

4-Benzyl-2,2-dimethylmorpholine is generally considered safe when handled under ...

84761-04-64-Benzyl-2,2-dimethy...
Compound Q&A

What is (5,6-Dimethoxy-3-pyridinyl)boronic acid (CAS: 1346526-61-1)?

(5,6-Dimethoxy-3-pyridinyl)boronic acid is a chemical compound with the molecula...

1346526-61-1(5,6-Dimethoxy-3-pyr...
Compound Q&A

How is 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane (CAS: 67875-55-2) typically synthesized?

1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane is synthesized throug...

67875-55-21,1,3,3-Tetramethyl-...
Compound Q&A

What are the main uses of (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid (CAS: 1018818-04-6)?

(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid is primarily used as a build...

1018818-04-6(2R,4S)-1-Boc-4-meth...