Compound Q&A

What are the physical and chemical properties of 3-(5,5,6-Trimethylbicyclo[2.2.1]hept-2-yl)cyclohexanol (CAS: 3407-42-9)?

Answer

3-(5,5,6-Trimethylbicyclo[2.2.1]hept-2-yl)cyclohexanol
3-(5,5,6-Trimethylbicyclo[2.2.1]hept-2-yl)cyclohexanol is a colorless liquid with a molecular weight of approximately 188.3 g/mol. It has a moderate solubility in water and is more soluble in organic solvents. This compound is relatively stable but can react with strong acids or bases. It has a specific gravity of 0.91 g/cm³ and a boiling point of around 125°C. It is not flammable but should be handled with care due to its chemical reactivity.

About

CAS No 3407-42-9
English Name 3-(5,5,6-Trimethylbicyclo[2.2.1]hept-2-yl)cyclohexanol
Molecular Formula C16H28O
Molecular Weight 236.4 g/mol
SMILES OC1CC(C2C(C3)C(C)C(C)(C)C3C2)CCC1
InChIKey BWVZAZPLUTUBKD-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:06

Related Q&A

Compound Q&A

How is 3-(5,5,6-Trimethylbicyclo[2.2.1]hept-2-yl)cyclohexanol (CAS: 3407-42-9) typically synthesized?

3-(5,5,6-Trimethylbicyclo[2.2.1]hept-2-yl)cyclohexanol is typically synthesized via a ring-opening r...

Compound Q&A

What industries use 3-(5,5,6-Trimethylbicyclo[2.2.1]hept-2-yl)cyclohexanol (CAS: 3407-42-9)?

3-(5,5,6-Trimethylbicyclo[2.2.1]hept-2-yl)cyclohexanol is used in various industries. It is a key in...

Compound Q&A

What precautions should be taken when handling 3-(5,5,6-Trimethylbicyclo[2.2.1]hept-2-yl)cyclohexanol (CAS: 3407-42-9)?

When handling 3-(5,5,6-Trimethylbicyclo[2.2.1]hept-2-yl)cyclohexanol, it is important to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...