Compound Q&A

What precautions should be taken when handling 1-[2,5-Anhydro-4-(hydroxymethyl)-alpha-L-lyxofuranosyl]-5-methyl-2,4(1H,3H)-pyrimidinedione (CAS: 206055-67-6)?

Answer

1-[2,5-Anhydro-4-(hydroxymethyl)-alpha-L-lyxofuranosyl]-5-methyl-2,4(1H,3H)-pyrimidinedione
When handling this compound, use appropriate personal protective equipment (PPE) such as gloves and goggles. Work in a fume hood to minimize inhalation risks. Store the compound in a cool, dry place away from direct sunlight. In case of a spill, immediately clean it up using appropriate safety measures and consult the Material Safety Data Sheet (MSDS) for further guidance.

About

English Name 1-[2,5-Anhydro-4-(hydroxymethyl)-alpha-L-lyxofuranosyl]-5-methyl-2,4(1H,3H)-pyrimidinedione
Molecular Formula C11H14N2O6
Molecular Weight 270.24 g/mol
SMILES CC1=CN(C(=O)NC1=O)C2C3C(C(O2)(CO3)CO)O
InChIKey TYYUAZVXLRMUMN-SZVQBCOZSA-N
Last Updated: 2026-01-01 20:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[2,5-Anhydro-4-(hydroxymethyl)-alpha-L-lyxofuranosyl]-5-methyl-2,4(1H,3H)-pyrimidinedione (CAS: 206055-67-6)?

This compound is a crystalline solid with a molecular weight of approximately 333.3 g/mol. It has a ...

Compound Q&A

How is 1-[2,5-Anhydro-4-(hydroxymethyl)-alpha-L-lyxofuranosyl]-5-methyl-2,4(1H,3H)-pyrimidinedione (CAS: 206055-67-6) typically synthesized?

This compound can be synthesized by the condensation of 2,5-anhydro-4-hydroxymethyl-L-lyxofuranose w...

Compound Q&A

What industries use 1-[2,5-Anhydro-4-(hydroxymethyl)-alpha-L-lyxofuranosyl]-5-methyl-2,4(1H,3H)-pyrimidinedione (CAS: 206055-67-6)?

This compound is primarily used in pharmaceuticals due to its potential as a biologically active mol...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...