Compound Q&A

What are the physical and chemical properties of Dicyclohexylamine 3-oxo-1-phenyl-2,7,10-trioxa-4-azadodecan-12-oate (CAS: 560088-84-8)?

Answer

Dicyclohexylamine 3-oxo-1-phenyl-2,7,10-trioxa-4-azadodecan-12-oate
Dicyclohexylamine 3-oxo-1-phenyl-2,7,10-trioxa-4-azadodecan-12-oate is a white crystalline solid with a high molecular weight. It has low water solubility and moderate solubility in organic solvents. The compound is moderately reactive, showing some ester and amide functionalities. Its reactivity can vary depending on the specific conditions and other functional groups present.

About

English Name Dicyclohexylamine 3-oxo-1-phenyl-2,7,10-trioxa-4-azadodecan-12-oate
Molecular Formula C26H42N2O6
Molecular Weight 478.63 g/mol
SMILES C1CCC(CC1)NC2CCCCC2.C1=CC=C(C=C1)COC(=O)NCCOCCOCC(=O)O
InChIKey BPBKWLNXKRAXFJ-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:06

Related Q&A

Compound Q&A

How is Dicyclohexylamine 3-oxo-1-phenyl-2,7,10-trioxa-4-azadodecan-12-oate (CAS: 560088-84-8) typically synthesized?

Dicyclohexylamine 3-oxo-1-phenyl-2,7,10-trioxa-4-azadodecan-12-oate is synthesized through a multi-s...

Compound Q&A

What industries use Dicyclohexylamine 3-oxo-1-phenyl-2,7,10-trioxa-4-azadodecan-12-oate (CAS: 560088-84-8)?

Dicyclohexylamine 3-oxo-1-phenyl-2,7,10-trioxa-4-azadodecan-12-oate finds applications in the pharma...

Compound Q&A

What precautions should be taken when handling Dicyclohexylamine 3-oxo-1-phenyl-2,7,10-trioxa-4-azadodecan-12-oate (CAS: 560088-84-8)?

When handling Dicyclohexylamine 3-oxo-1-phenyl-2,7,10-trioxa-4-azadodecan-12-oate, it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...