Compound Q&A

What precautions should be taken when handling Di-(2Z)-2-nonen-1-yl 9-{[4-(dimethylamino)butanoyl]oxy}heptadecanedioate (CAS: 1351586-50-9)?

Answer

Di-(2Z)-2-nonen-1-yl 9-{[4-(dimethylamino)butanoyl]oxy}heptadecanedioate
When handling Di-(2Z)-2-nonen-1-yl 9-{[4-(dimethylamino)butanoyl]oxy}heptadecanedioate, wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Handle in a well-ventilated area or a fume hood to minimize inhalation exposure. Follow standard laboratory safety procedures, and consult the Safety Data Sheet (SDS) for specific details on handling and disposal.

About

English Name Di-(2Z)-2-nonen-1-yl 9-{[4-(dimethylamino)butanoyl]oxy}heptadecanedioate
Molecular Formula C41H75NO6
Molecular Weight 678.05 g/mol
SMILES CN(C)CCCC(=O)OC(CCCCCCCC(=O)OC/C=C\CCCCCC)CCCCCCCC(=O)OC/C=C\CCCCCC
InChIKey DGNMJYUPWDTKJB-ZDSKVHJSSA-N
Last Updated: 2026-01-01 20:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of Di-(2Z)-2-nonen-1-yl 9-{[4-(dimethylamino)butanoyl]oxy}heptadecanedioate (CAS: 1351586-50-9)?

Di-(2Z)-2-nonen-1-yl 9-{[4-(dimethylamino)butanoyl]oxy}heptadecanedioate has a crystalline form, a m...

Compound Q&A

How is Di-(2Z)-2-nonen-1-yl 9-{[4-(dimethylamino)butanoyl]oxy}heptadecanedioate (CAS: 1351586-50-9) typically synthesized?

Di-(2Z)-2-nonen-1-yl 9-{[4-(dimethylamino)butanoyl]oxy}heptadecanedioate is synthesized via esterifi...

Compound Q&A

What industries use Di-(2Z)-2-nonen-1-yl 9-{[4-(dimethylamino)butanoyl]oxy}heptadecanedioate (CAS: 1351586-50-9)?

Di-(2Z)-2-nonen-1-yl 9-{[4-(dimethylamino)butanoyl]oxy}heptadecanedioate is used in the pharmaceutic...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...