Compound Q&A

What precautions should be taken when handling Azd7325 (CAS: 942437-37-8)?

Answer

Azd7325
When handling Azd7325, it is crucial to work in a fume hood to avoid inhalation exposure. Personal protective equipment (PPE) including gloves, lab coat, and safety goggles should be worn at all times. Spills should be cleaned up using appropriate absorbent materials, and the Material Safety Data Sheet (MSDS) should be consulted for detailed safety information.

About

English Name Azd7325
Molecular Formula C19H19FN4O2
Molecular Weight 354.39 g/mol
SMILES CCCNC(=O)C1=NN=C2C(=C1N)C=CC=C2C3=C(C=CC=C3F)OC
InChIKey KYDURMHFWXCKMW-UHFFFAOYSA-N
Last Updated: 2026-01-01 20:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of Azd7325 (CAS: 942437-37-8)?

Azd7325 is a crystalline compound with a molecular weight of approximately 444.4 g/mol. It is poorly...

Compound Q&A

How is Azd7325 (CAS: 942437-37-8) typically synthesized?

Azd7325 is synthesized through a multi-step process involving oxyamination and subsequent functional...

Compound Q&A

What industries use Azd7325 (CAS: 942437-37-8)?

Azd7325 is primarily used in the pharmaceutical industry due to its specific biological activity. It...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...