Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 1H-spiro[isoquinoline-4,4'-piperidine]-2(3H)-carboxylate hydrochloride (CAS: 889139-52-0)?

Answer

2-Methyl-2-propanyl 1H-spiro[isoquinoline-4,4'-piperidine]-2(3H)-carboxylate hydrochloride (1:1)
This compound is a crystalline solid with a molecular weight of approximately 346.37 g/mol. It is slightly soluble in water and has a pKa of around 3.5. It is reactive towards bases and can undergo hydrolysis under basic conditions.

About

English Name 2-Methyl-2-propanyl 1H-spiro[isoquinoline-4,4'-piperidine]-2(3H)-carboxylate hydrochloride (1:1)
Molecular Formula C18H27ClN2O2
Molecular Weight 338.88 g/mol
SMILES CC(C)(C)OC(=O)N1CC2=CC=CC=C2C3(C1)CCNCC3.Cl
InChIKey VZPJVDIMBQBNBX-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:35

Related Q&A

Compound Q&A

How is 2-Methyl-2-proanyl 1H-spiro[isoquinoline-4,4'-piperidine]-2(3H)-carboxylate hydrochloride (CAS: 889139-52-0) typically synthesized?

This compound is usually synthesized via a multistep process involving the coupling of 2-methyl-2-pr...

Compound Q&A

What industries use 2-Methyl-2-proanyl 1H-spiro[isoquinoline-4,4'-piperidine]-2(3H)-carboxylate hydrochloride (CAS: 889139-52-0)?

This compound is primarily used in the pharmaceutical industry for its potential as a drug precursor...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 1H-spiro[isoquinoline-4,4'-piperidine]-2(3H)-carboxylate hydrochloride (CAS: 889139-52-0)?

Handling this compound requires the use of personal protective equipment (PPE) including gloves, gog...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...