Compound Q&A

What are the physical and chemical properties of 9-Benzyl-2,9-diazaspiro[5.5]undecane dihydrochloride (CAS: 1198286-24-6)?

Answer

9-Benzyl-2,9-diazaspiro[5.5]undecane dihydrochloride
9-Benzyl-2,9-diazaspiro[5.5]undecane dihydrochloride is a crystalline compound with a molecular weight of approximately 282.32 g/mol. It has a low solubility in water but is soluble in organic solvents like methanol and ethanol. Chemically, it is relatively stable but can react with bases to form the free base. It is often used in medicinal chemistry and drug design.

About

English Name 9-Benzyl-2,9-diazaspiro[5.5]undecane dihydrochloride
Molecular Formula C16H26Cl2N2
Molecular Weight 317.3 g/mol
SMILES C1CC2(CCN(CC2)CC3=CC=CC=C3)CNC1.Cl.Cl
InChIKey XGJSNBAOPRYLDZ-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:35

Related Q&A

Compound Q&A

How is 9-Benzyl-2,9-diazaspiro[5.5]undecane dihydrochloride (CAS: 1198286-24-6) typically synthesized?

9-Benzyl-2,9-diazaspiro[5.5]undecane dihydrochloride is typically synthesized through multistep synt...

Compound Q&A

What industries use 9-Benzyl-2,9-diazaspiro[5.5]undecane dihydrochloride (CAS: 1198286-24-6)?

9-Benzyl-2,9-diazaspiro[5.5]undecane dihydrochloride is primarily used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling 9-Benzyl-2,9-diazaspiro[5.5]undecane dihydrochloride (CAS: 1198286-24-6)?

When handling 9-Benzyl-2,9-diazaspiro[5.5]undecane dihydrochloride, it is important to use personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...