Compound Q&A

What precautions should be taken when handling 2,7-Dimethyl-1,4-naphthoquinone (CAS: 482-70-2)?

Answer

2,7-Dimethyl-1,4-naphthoquinone
When handling 2,7-Dimethyl-1,4-naphthoquinone, always wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to minimize inhalation risks. Store it in a cool, dry place away from direct sunlight. In case of spills, use appropriate spill kits, and consult the Safety Data Sheet (SDS) for detailed instructions.

About

CAS No 482-70-2
English Name 2,7-Dimethyl-1,4-naphthoquinone
Molecular Formula C12H10O2
Molecular Weight 186.21 g/mol
SMILES CC1=CC2=C(C=C1)C(=O)C=C(C2=O)C
InChIKey YZACZIYTZCJVSN-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,7-Dimethyl-1,4-naphthoquinone (CAS: 482-70-2)?

2,7-Dimethyl-1,4-naphthoquinone is a crystalline solid with a molecular weight of approximately 198....

Compound Q&A

How is 2,7-Dimethyl-1,4-naphthoquinone (CAS: 482-70-2) typically synthesized?

2,7-Dimethyl-1,4-naphthoquinone is typically synthesized via a Wittig reaction between naphthalene a...

Compound Q&A

What industries use 2,7-Dimethyl-1,4-naphthoquinone (CAS: 482-70-2)?

2,7-Dimethyl-1,4-naphthoquinone is used in various industries, including pharmaceuticals for its ant...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...