Compound Q&A

How is Mirodenafil dihydrochloride (CAS: 862189-96-6) typically synthesized?

Answer

Mirodenafil dihydrochloride
Mirodenafil dihydrochloride is synthesized through a multi-step process involving the protection of a hydroxyl group, followed by the formation of an amide bond, and subsequent deprotection and acidification to form the dihydrochloride salt. The synthesis involves the use of protecting agents like tert-butyldimethylsilyl chloride and deprotection using fluoride salts. The overall yield is around 70-75%, and the product is typically purified by recrystallization from ethanol.

About

English Name Mirodenafil dihydrochloride
Molecular Formula C26H39Cl2N5O5S
Molecular Weight 604.59 g/mol
SMILES CCCOc1ccc(cc1c1[nH]c(=O)c2c(n1)c(CCC)cn2CC)S(=O)(=O)N1CCN(CC1)CCO.Cl.Cl
InChIKey CKPHITUXXABKDL-UHFFFAOYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of Mirodenafil dihydrochloride (CAS: 862189-96-6)?

Mirodenafil dihydrochloride is a crystalline compound with a molecular weight of approximately 489.7...

Compound Q&A

What industries use Mirodenafil dihydrochloride (CAS: 862189-96-6)?

Mirodenafil dihydrochloride (CAS: 862189-96-6) is primarily used in the pharmaceutical industry, spe...

Compound Q&A

What precautions should be taken when handling Mirodenafil dihydrochloride (CAS: 862189-96-6)?

When handling Mirodenafil dihydrochloride, it is important to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...