Compound Q&A

What precautions should be taken when handling Pterisolic acid E (CAS: 1401419-89-3)?

Answer

Pterisolic acid E
When handling Pterisolic acid E (CAS: 1401419-89-3), ensure the use of personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a fume hood to avoid inhalation or skin contact. Store the compound in a cool, dry place away from direct sunlight. In case of a spill, use appropriate spill cleanup kits and refer to the Safety Data Sheet (SDS) for specific instructions.

About

English Name Pterisolic acid E
Molecular Formula C20H30O5
Molecular Weight 350.46 g/mol
SMILES CC1C2CC3(C1=O)CCC4C(CCCC4(C3(CC2O)O)C)(C)C(=O)O
InChIKey IZIVAPRKBMMUKE-NBVFGAQYSA-N
Last Updated: 2026-01-01 15:34

Related Q&A

Compound Q&A

What are the physical and chemical properties of Pterisolic acid E (CAS: 1401419-89-3)?

Pterisolic acid E (CAS: 1401419-89-3) is a crystalline compound with a molecular weight of approxima...

Compound Q&A

How is Pterisolic acid E (CAS: 1401419-89-3) typically synthesized?

Pterisolic acid E (CAS: 1401419-89-3) can be synthesized by hydrolysis of a corresponding ester usin...

Compound Q&A

What industries use Pterisolic acid E (CAS: 1401419-89-3)?

Pterisolic acid E (CAS: 1401419-89-3) is used in the pharmaceutical industry for its potential anti-...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...