Compound Q&A

What are the physical and chemical properties of 4H-Carbazol-4-one hydrochloride (CAS: 99614-70-7)?

Answer

4H-Carbazol-4-one hydrochloride (1:1)
4H-Carbazol-4-one hydrochloride (CAS: 99614-70-7) is a crystalline compound with a molecular weight of approximately 266.8 g/mol. It has a high solubility in water and organic solvents. Chemically, it is less reactive compared to other carbazoles, making it stable under normal conditions. This compound is commonly used in the synthesis of functional materials and pharmaceuticals.

About

CAS No 99614-70-7
English Name 4H-Carbazol-4-one hydrochloride (1:1)
Molecular Formula C12H8ClNO
Molecular Weight 217.65 g/mol
SMILES C1=CC2=C3C(=O)C=CC=C3N=C2C=C1.Cl
InChIKey WYXPBFJNQZWFCO-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

How is 4H-Carbazol-4-one hydrochloride (CAS: 99614-70-7) typically synthesized?

4H-Carbazol-4-one hydrochloride (CAS: 99614-70-7) is synthesized through the condensation of benzald...

Compound Q&A

What industries use 4H-Carbazol-4-one hydrochloride (CAS: 99614-70-7)?

4H-Carbazol-4-one hydrochloride (CAS: 99614-70-7) is used in various industries. It is a key interme...

Compound Q&A

What precautions should be taken when handling 4H-Carbazol-4-one hydrochloride (CAS: 99614-70-7)?

When handling 4H-Carbazol-4-one hydrochloride (CAS: 99614-70-7), it is essential to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...