Compound Q&A

What are the physical and chemical properties of 1-(3,4-Dichlorophenyl)-2-oxopyrrolidine-4-carboxylic acid (CAS: 91064-25-4)?

Answer

1-(3,4-Dichlorophenyl)-2-oxopyrrolidine-4-carboxylic acid
1-(3,4-Dichlorophenyl)-2-oxopyrrolidine-4-carboxylic acid is a white to off-white crystalline solid with a molecular weight of approximately 280.03 g/mol. It has a low solubility in water but is more soluble in organic solvents like methanol and acetonitrile. This compound is known for its stability, but it can undergo hydrolysis under basic conditions. It is also prone to esterification and amide formation reactions.

About

CAS No 91064-25-4
English Name 1-(3,4-Dichlorophenyl)-2-oxopyrrolidine-4-carboxylic acid
Molecular Formula C11H9Cl2NO3
Molecular Weight 274.1 g/mol
SMILES C1C(CN(C1=O)C2=CC(=C(C=C2)Cl)Cl)C(=O)O
InChIKey WMACFMOMYRKMOJ-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

How is 1-(3,4-Dichlorophenyl)-2-oxopyrrolidine-4-carboxylic acid (CAS: 91064-25-4) typically synthesized?

1-(3,4-Dichlorophenyl)-2-oxopyrrolidine-4-carboxylic acid can be synthesized via a multi-step proces...

Compound Q&A

What industries use 1-(3,4-Dichlorophenyl)-2-oxopyrrolidine-4-carboxylic acid (CAS: 91064-25-4)?

1-(3,4-Dichlorophenyl)-2-oxopyrrolidine-4-carboxylic acid is used in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling 1-(3,4-Dichlorophenyl)-2-oxopyrrolidine-4-carboxylic acid (CAS: 91064-25-4)?

When handling 1-(3,4-Dichlorophenyl)-2-oxopyrrolidine-4-carboxylic acid, it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...