Compound Q&A

What industries use 1-Chloro-4-(ethylsulfonyl)-2-nitrobenzene (CAS: 74159-80-1)?

Answer

1-Chloro-4-(ethylsulfonyl)-2-nitrobenzene
1-Chloro-4-(ethylsulfonyl)-2-nitrobenzene is utilized in the pharmaceutical industry for the synthesis of certain medicinal compounds. It is also used in the production of sensors and in the field of materials science for developing advanced polymers and semiconductors. Its specific applications include intermediates in drug synthesis and as a functional group for derivatization in analytical chemistry.

About

CAS No 74159-80-1
English Name 1-Chloro-4-(ethylsulfonyl)-2-nitrobenzene
Molecular Formula C8H8ClNO4S
Molecular Weight 249.67 g/mol
SMILES CCS(=O)(=O)C1=CC(=C(C=C1)Cl)[N+](=O)[O-]
InChIKey VETAODCIKKRRTR-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Chloro-4-(ethylsulfonyl)-2-nitrobenzene (CAS: 74159-80-1)?

1-Chloro-4-(ethylsulfonyl)-2-nitrobenzene is a crystalline solid with a molecular weight of 278.23 g...

Compound Q&A

How is 1-Chloro-4-(ethylsulfonyl)-2-nitrobenzene (CAS: 74159-80-1) typically synthesized?

1-Chloro-4-(ethylsulfonyl)-2-nitrobenzene can be synthesized through a series of steps involving nit...

Compound Q&A

What precautions should be taken when handling 1-Chloro-4-(ethylsulfonyl)-2-nitrobenzene (CAS: 74159-80-1)?

When handling 1-Chloro-4-(ethylsulfonyl)-2-nitrobenzene, it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...