Compound Q&A

What are the physical and chemical properties of Dihydro Galanthaminone (CAS: 21041-10-1)?

Answer

Dihydro Galanthaminone
Dihydro Galanthaminone (CAS: 21041-10-1) is a crystalline compound with a molecular weight of approximately 266.29 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol and acetone. Chemically, it is relatively stable under normal conditions but can be reactive towards strong bases.

About

CAS No 21041-10-1
English Name Dihydro Galanthaminone
Molecular Formula C17H21NO3
Molecular Weight 287.36 g/mol
SMILES CN1CCC23CCC(=O)CC2Oc4c3c(ccc4OC)C1
InChIKey UFQNQEIAGBZCBL-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

How is Dihydro Galanthaminone (CAS: 21041-10-1) typically synthesized?

Dihydro Galanthaminone (CAS: 21041-10-1) is typically synthesized via a sequence of reactions involv...

Compound Q&A

What industries use Dihydro Galanthaminone (CAS: 21041-10-1)?

Dihydro Galanthaminone (CAS: 21041-10-1) is primarily used in the pharmaceutical industry for the de...

Compound Q&A

What precautions should be taken when handling Dihydro Galanthaminone (CAS: 21041-10-1)?

When handling Dihydro Galanthaminone (CAS: 21041-10-1), ensure proper personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...