Compound Q&A

What industries use Nicotinonitrile 1-oxide (CAS: 149060-64-0)?

Answer

Nicotinonitrile 1-oxide
Nicotinonitrile 1-oxide finds applications in the pharmaceutical industry for the synthesis of certain drug intermediates. It is also used in the production of organic compounds and as a reagent in analytical chemistry and sensor technology.

About

English Name Nicotinonitrile 1-oxide
Molecular Formula C6H4N2O
Molecular Weight 275.73 g/mol
SMILES C1=CC(=C[N+](=C1)[O-])C#N
InChIKey WOOVSQCALYYUDO-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of Nicotinonitrile 1-oxide (CAS: 149060-64-0)?

Nicotinonitrile 1-oxide (CAS: 149060-64-0) is a crystalline solid with a molecular weight of approxi...

Compound Q&A

How is Nicotinonitrile 1-oxide (CAS: 149060-64-0) typically synthesized?

Nicotinonitrile 1-oxide can be synthesized through the oxidation of nicotinonitrile using potassium ...

Compound Q&A

What precautions should be taken when handling Nicotinonitrile 1-oxide (CAS: 149064-0)?

When handling Nicotinonitrile 1-oxide, it is important to wear appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...