Compound Q&A

What industries use 1-Oxido-2-pyridinyl carbamimidothioate hydrochloride (CAS: 2770-93-6)?

Answer

1-Oxido-2-pyridinyl carbamimidothioate hydrochloride (1:1)
1-Oxido-2-pyridinyl carbamimidothioate hydrochloride (CAS: 2770-93-6) is used in various industries, particularly in pharmaceuticals and chemical synthesis. It serves as a key intermediate in the preparation of other compounds and is also used in the development of certain sensor technologies and as a reagent in organic synthesis.

About

CAS No 2770-93-6
English Name 1-Oxido-2-pyridinyl carbamimidothioate hydrochloride (1:1)
Molecular Formula C6H8ClN3OS
Molecular Weight 205.67 g/mol
SMILES C1=CC=[N+](C(=C1)SC(=N)N)[O-].Cl
InChIKey QTHDIGATKRFRKS-UHFFFAOYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Oxido-2-pyridinyl carbamimidothioate hydrochloride (CAS: 2770-93-6)?

1-Oxido-2-pyridinyl carbamimidothioate hydrochloride (CAS: 2770-93-6) is a crystalline solid with a ...

Compound Q&A

How is 1-Oxido-2-pyridinyl carbamimidothioate hydrochloride (CAS: 2770-93-6) typically synthesized?

1-Oxido-2-pyridinyl carbamimidothioate hydrochloride (CAS: 2770-93-6) is typically synthesized by th...

Compound Q&A

What precautions should be taken when handling 1-Oxido-2-pyridinyl carbamimidothioate hydrochloride (CAS: 2770-93-6)?

When handling 1-Oxido-2-pyridinyl carbamimidothioate hydrochloride (CAS: 2770-93-6), it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...