Compound Q&A

What precautions should be taken when handling (7aS)-6-Phenylhexahydroimidazo[2,1-b][1,3]thiazoletriium phosphate (CAS: 32093-35-9)?

Answer

(7aS)-6-Phenylhexahydroimidazo[2,1-b][1,3]thiazoletriium phosphate
When handling (7aS)-6-Phenylhexahydroimidazo[2,1-b][1,3]thiazoletriium phosphate (CAS: 32093-35-9), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. This compound should be handled in a well-ventilated area or a fume hood. Spills should be cleaned up immediately using appropriate methods and tools, and the area should be thoroughly ventilated. Always refer to the safety data sheet (SDS) for specific handling instructions and emergency procedures.

About

CAS No 32093-35-9
English Name (7aS)-6-Phenylhexahydroimidazo[2,1-b][1,3]thiazoletriium phosphate
Molecular Formula C11H17N2O4PS
Molecular Weight 302.29 g/mol
SMILES C1CSC2=NC(CN21)C3=CC=CC=C3.OP(=O)(O)O
InChIKey ALZJNPBSFWBUEB-GQNCZFCYSA-N
Last Updated: 2026-01-01 10:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of (7aS)-6-Phenylhexahydroimidazo[2,1-b][1,3]thiazoletriium phosphate (CAS: 32093-35-9)?

The compound (7aS)-6-Phenylhexahydroimidazo[2,1-b][1,3]thiazoletriium phosphate (CAS: 32093-35-9) is...

Compound Q&A

How is (7aS)-6-Phenylhexahydroimidazo[2,1-b][1,3]thiazoletriium phosphate (CAS: 32093-35-9) typically synthesized?

(7aS)-6-Phenylhexahydroimidazo[2,1-b][1,3]thiazoletriium phosphate (CAS: 32093-35-9) can be synthesi...

Compound Q&A

What industries use (7aS)-6-Phenylhexahydroimidazo[2,1-b][1,3]thiazoletriium phosphate (CAS: 32093-35-9)?

(7aS)-6-Phenylhexahydroimidazo[2,1-b][1,3]thiazoletriium phosphate (CAS: 32093-35-9) is primarily us...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...