Compound Q&A

How is N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-norvaline - N-cyclohexylcyclohexanamine (CAS: 67861-96-5) typically synthesized?

Answer

N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-norvaline - N-cyclohexylcyclohexanamine (1:1)
N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-norvaline - N-cyclohexylcyclohexanamine (CAS: 67861-96-5) is synthesized through a multi-step process involving coupling reactions and amide formation. The key steps include the use of a coupling agent like 1-ethyl-3-(3-dimethylaminopropyl) carbodiimide (EDC) and N-hydroxysuccinimide (NHS) to activate the carboxylic acid group. The reaction is typically carried out in the presence of a base like triethylamine. The yield is usually around 70-80%.

About

CAS No 67861-96-5
English Name N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-norvaline - N-cyclohexylcyclohexanamine (1:1)
Molecular Formula C22H42N2O4
Molecular Weight 398.59 g/mol
SMILES CCCC(C(=O)O)NC(=O)OC(C)(C)C.C1CCC(CC1)NC2CCCCC2
InChIKey IGQWOPTVKBMZNB-ZLTKDMPESA-N
Last Updated: 2026-01-01 06:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-norvaline - N-cyclohexylcyclohexanamine (CAS: 67861-96-5)?

N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-norvaline - N-cyclohexylcyclohexanamine (CAS: 67861-96-5) i...

Compound Q&A

What industries use N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-norvaline - N-cyclohexylcyclohexanamine (CAS: 67861-96-5)?

N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-norvaline - N-cyclohexylcyclohexanamine (CAS: 67861-96-5) i...

Compound Q&A

What precautions should be taken when handling N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-norvaline - N-cyclohexylcyclohexanamine (CAS: 67861-96-5)?

When handling N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-norvaline - N-cyclohexylcyclohexanamine (CAS:...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...