Compound Q&A

What are the physical and chemical properties of N-(4-Bromonaphthalen-1-yl)acetamide (CAS: 91394-66-0)?

Answer

N-(4-Bromonaphthalen-1-yl)acetamide
N-(4-Bromonaphthalen-1-yl)acetamide (CAS: 91394-66-0) is a white crystalline solid with a molecular weight of approximately 286.11 g/mol. It has a solubility of about 0.02 g/100 mL in water and is poorly soluble in most organic solvents. This compound exhibits limited reactivity under normal conditions but can undergo substitution reactions under certain conditions. It is stable under normal temperature and pressure but should be stored away from direct sunlight and heat sources.

About

CAS No 91394-66-0
English Name N-(4-Bromonaphthalen-1-yl)acetamide
Molecular Formula C12H10BrNO
Molecular Weight 264.12 g/mol
SMILES CC(=O)NC1=CC=C(C2=CC=CC=C21)Br
InChIKey KAVKNHPXAMTURG-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

How is N-(4-Bromonaphthalen-1-yl)acetamide (CAS: 91394-66-0) typically synthesized?

N-(4-Bromonaphthalen-1-yl)acetamide (CAS: 91394-66-0) is typically synthesized by the reaction of 4-...

Compound Q&A

What industries use N-(4-Bromonaphthalen-1-yl)acetamide (CAS: 91394-66-0)?

N-(4-Bromonaphthalen-1-yl)acetamide (CAS: 91394-66-0) is primarily used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling N-(4-Bromonaphthalen-1-yl)acetamide (CAS: 91394-66-0)?

When handling N-(4-Bromonaphthalen-1-yl)acetamide (CAS: 91394-66-0), appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...