Compound Q&A

What are the physical and chemical properties of Disperse Orange 73 (CAS: 79300-11-1)?

Answer

Disperse Orange 73
Disperse Orange 73 (CAS: 79300-11-1) is a water-insoluble azo dye with a crystalline form. It has a molecular weight of approximately 562.4 g/mol and exhibits good light and heat stability. The dye is moderately soluble in organic solvents like acetone and alcohols but is practically insoluble in water. Its chemical reactivity is minimal due to its azo linkage, making it stable under normal conditions.

About

CAS No 79300-11-1
English Name Disperse Orange 73
Molecular Formula C24H21N5O4
Molecular Weight 443.45 g/mol
SMILES N#CCCN(C1C=CC(/N=N/C2C=CC([N+]([O-])=O)=CC=2)=CC=1)CCOC(C1C=CC=CC=1)=O
InChIKey SCLYXZFZPIKFAH-CYYJNZCTSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

How is Disperse Orange 73 (CAS: 79300-11-1) typically synthesized?

Disperse Orange 73 (CAS: 79300-11-1) is synthesized through a typical azo coupling reaction using a ...

Compound Q&A

What industries use Disperse Orange 73 (CAS: 79300-11-1)?

Disperse Orange 73 (CAS: 79300-11-1) is widely used in the textile and dyeing industries for colorin...

Compound Q&A

What precautions should be taken when handling Disperse Orange 73 (CAS: 79300-11-1)?

When handling Disperse Orange 73 (CAS: 79300-11-1), it is essential to use appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...