Compound Q&A

What are the physical and chemical properties of (5-Thioxo-2,5-dihydro-1H-tetrazol-1-yl)methanesulfonic acid (CAS: 67146-22-9)?

Answer

(5-Thioxo-2,5-dihydro-1H-tetrazol-1-yl)methanesulfonic acid
This compound is a crystalline solid with a molecular weight of approximately 238.27 g/mol. It has a pKa of about 1.5, indicating strong acidity. The compound is soluble in water and organic solvents. It reacts readily with bases to form tetrazolium salts. It is also known for its reactivity towards nucleophiles and its use in various chemical transformations.

About

CAS No 67146-22-9
English Name (5-Thioxo-2,5-dihydro-1H-tetrazol-1-yl)methanesulfonic acid
Molecular Formula C2H4N4O3S2
Molecular Weight 196.21 g/mol
SMILES C(N1C(=S)N=NN1)S(=O)(=O)O
InChIKey NLDLXEAUMGUSPX-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

How is (5-Thioxo-2,5-dihydro-1H-tetrazol-1-yl)methanesulfonic acid (CAS: 67146-22-9) typically synthesized?

This compound is often synthesized through the reaction of methanesulfonic acid with 5-thioxo-2,5-di...

Compound Q&A

What industries use (5-Thioxo-2,5-dihydro-1H-tetrazol-1-yl)methanesulfonic acid (CAS: 67146-22-9)?

This compound is widely used in the pharmaceutical industry for the synthesis of drug intermediates....

Compound Q&A

What precautions should be taken when handling (5-Thioxo-2,5-dihydro-1H-tetrazol-1-yl)methanesulfonic acid (CAS: 67146-22-9)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...