Compound Q&A

What are the physical and chemical properties of 5-Amino-2-butylbenzofuran-3-yl (4-(3-(dibutyl-amino)propoxy)phenyl) oxalate (CAS: 851014-95-4)?

Answer

5-Amino-2-butylbenzofuran-3-yl (4-(3-(dibutyl-amino)propoxy)phenyl) oxalate
5-Amino-2-butylbenzofuran-3-yl (4-(3-(dibutyl-amino)propoxy)phenyl) oxalate (CAS: 851014-95-4) is a crystalline compound with a molecular weight of approximately 554.7 g/mol. It has low solubility in water but good solubility in organic solvents such as methanol and ethanol. This compound is reactive and can undergo various chemical transformations, making it suitable for use in medicinal chemistry and materials science.

About

English Name 5-Amino-2-butylbenzofuran-3-yl (4-(3-(dibutyl-amino)propoxy)phenyl) oxalate
Molecular Formula C31H42N2O6
Molecular Weight 538.69 g/mol
SMILES CCCCC1=C(C2=C(O1)C=CC(=C2)N)OC(=O)C(=O)OC3=CC=C(C=C3)OCCCN(CCCC)CCCC
InChIKey MFHTVWRTNCBWPZ-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

How is 5-Amino-2-butylbenzofuran-3-yl (4-(3-(dibutyl-amino)propoxy)phenyl) oxalate (CAS: 851014-95-4) typically synthesized?

5-Amino-2-butylbenzofuran-3-yl (4-(3-(dibutyl-amino)propoxy)phenyl) oxalate (CAS: 851014-95-4) is sy...

Compound Q&A

What industries use 5-Amino-2-butylbenzofuran-3-yl (4-(3-(dibutyl-amino)propoxy)phenyl) oxalate (CAS: 851014-95-4)?

5-Amino-2-butylbenzofuran-3-yl (4-(3-(dibutyl-amino)propoxy)phenyl) oxalate (CAS: 851014-95-4) is pr...

Compound Q&A

What precautions should be taken when handling 5-Amino-2-butylbenzofuran-3-yl (4-(3-(dibutyl-amino)propoxy)phenyl) oxalate (CAS: 851014-95-4)?

Proper personal protective equipment (PPE) should be worn when handling 5-Amino-2-butylbenzofuran-3-...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...