Compound Q&A

What industries use Cadmium ditetrafluoroborate (CAS: 14486-19-2)?

Answer

Cadmium ditetrafluoroborate
Cadmium ditetrafluoroborate (CAS: 14486-19-2) is primarily used in the pharmaceutical, semiconductor, and organic synthesis industries. It serves as a reagent in the preparation of various organic compounds and in the synthesis of coordination complexes. Due to its reactivity, it is also used in analytical chemistry and as a component in certain sensors.

About

CAS No 14486-19-2
English Name Cadmium ditetrafluoroborate
Molecular Formula B2CdF8
Molecular Weight 286.03 g/mol
SMILES [B-](F)(F)(F)F.[B-](F)(F)(F)F.[Cd+2]
InChIKey NXOFSPIMFJTFSE-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cadmium ditetrafluoroborate (CAS: 14486-19-2)?

Cadmium ditetrafluoroborate (CAS: 14486-19-2) is a white crystalline solid with a molecular weight o...

Compound Q&A

How is Cadmium ditetrafluoroborate (CAS: 14486-19-2) typically synthesized?

Cadmium ditetrafluoroborate is typically synthesized by treating cadmium chloride with tetrafluorobo...

Compound Q&A

What precautions should be taken when handling Cadmium ditetrafluoroborate (CAS: 14486-19-2)?

When handling Cadmium ditetrafluoroborate (CAS: 14486-19-2), it is essential to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...