Compound Q&A

How is Cholest-5-en-3-ol (CAS: 92543-08-3) typically synthesized?

Answer

(3beta)-(2,2,3,4,4,6-~2~H_6_)Cholest-5-en-3-ol
Cholest-5-en-3-ol can be synthesized through hydrogenation of cholesterol or its precursors. This process is catalyzed by palladium on carbon, typically using hydrogen gas at atmospheric pressure and room temperature. The yield is high, and the selectivity is excellent, ensuring the formation of the desired 5-en-3-ol structure.

About

CAS No 92543-08-3
English Name (3beta)-(2,2,3,4,4,6-~2~H_6_)Cholest-5-en-3-ol
Molecular Formula C27H40D6O
Molecular Weight 392.7 g/mol
SMILES CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C
InChIKey HVYWMOMLDIMFJA-HHPLMCQASA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cholest-5-en-3-ol (CAS: 92543-08-3)?

Cholest-5-en-3-ol (CAS: 92543-08-3) is a solid, waxy substance with a molecular weight of approximat...

Compound Q&A

What industries use Cholest-5-en-3-ol (CAS: 92543-08-3)?

Cholest-5-en-3-ol (CAS: 92543-08-3) is used in pharmaceuticals for the synthesis of steroid hormones...

Compound Q&A

What precautions should be taken when handling Cholest-5-en-3-ol (CAS: 92543-08-3)?

Handling Cholest-5-en-3-ol (CAS: 92543-08-3) requires safety measures such as wearing gloves, goggle...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...