Compound Q&A

What are the physical and chemical properties of (3beta,5alpha)-17-Oxoandrostan-3-yl 4-methylbenzenesulfonate (CAS: 10429-07-9)?

Answer

(3beta,5alpha)-17-Oxoandrostan-3-yl 4-methylbenzenesulfonate
(3beta,5alpha)-17-Oxoandrostan-3-yl 4-methylbenzenesulfonate is a crystalline compound with a molecular weight of approximately 432.48 g/mol. It has a low solubility in water but is soluble in organic solvents like methanol and ethanol. The compound is moderately reactive, displaying typical behavior for esters and sulfonates. It is stable under normal conditions but should be stored away from strong acids and bases.

About

CAS No 10429-07-9
English Name (3beta,5alpha)-17-Oxoandrostan-3-yl 4-methylbenzenesulfonate
Molecular Formula C26H36O4S
Molecular Weight 444.64 g/mol
SMILES Cc1ccc(cc1)S(=O)(=O)O[C@H]1CC[C@]2([C@H](C1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CCC2=O)C)C
InChIKey HNTMKSKJRZRWKS-MWLOVLLCSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

How is (3beta,5alpha)-17-Oxoandrostan-3-yl 4-methylbenzenesulfonate (CAS: 10429-07-9) typically synthesized?

(3beta,5alpha)-17-Oxoandrostan-3-yl 4-methylbenzenesulfonate is typically synthesized through a mult...

Compound Q&A

What industries use (3beta,5alpha)-17-Oxoandrostan-3-yl 4-methylbenzenesulfonate (CAS: 10429-07-9)?

(3beta,5alpha)-17-Oxoandrostan-3-yl 4-methylbenzenesulfonate finds applications in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling (3beta,5alpha)-17-Oxoandrostan-3-yl 4-methylbenzenesulfonate (CAS: 10429-07-9)?

When handling (3beta,5alpha)-17-Oxoandrostan-3-yl 4-methylbenzenesulfonate, proper personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...