Compound Q&A

What are the physical and chemical properties of 3,3'-Dichlorobiphenyl (CAS: 2050-67-1)?

Answer

3,3'-Dichlorobiphenyl
3,3'-Dichlorobiphenyl is a crystalline compound with a molecular weight of approximately 254.01 g/mol. It has a low solubility in water but is more soluble in organic solvents like benzene and chloroform. It is generally stable under normal conditions but can react with strong bases and reducing agents. Its stability makes it suitable for certain industrial applications.

About

CAS No 2050-67-1
English Name 3,3'-Dichlorobiphenyl
Molecular Formula C12H8Cl2
Molecular Weight 223.1 g/mol
SMILES C1=CC(=CC(=C1)Cl)C2=CC(=CC=C2)Cl
InChIKey KTXUOWUHFLBZPW-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

How is 3,3'-Dichlorobiphenyl (CAS: 2050-67-1) typically synthesized?

3,3'-Dichlorobiphenyl is typically synthesized through the chlorination of biphenyl using chlorine g...

Compound Q&A

What industries use 3,3'-Dichlorobiphenyl (CAS: 2050-67-1)?

3,3'-Dichlorobiphenyl is used in the manufacturing of certain types of flame retardants, pharmaceuti...

Compound Q&A

What precautions should be taken when handling 3,3'-Dichlorobiphenyl (CAS: 2050-67-1)?

When handling 3,3'-Dichlorobiphenyl, it is essential to use proper personal protective equipment (PP...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...