Compound Q&A

What are the physical and chemical properties of (6bR,10aS)-Ethyl 3-methyl-2,3,6b,7,10,10a-hexahydro-1H-pyrido[3',4':4,5]pyrrolo[1,2,3-de]quinoxaline-8(9H)-carboxylate (CAS: 313369-26-5)?

Answer

(6bR,10aS)-Ethyl 3-methyl-2,3,6b,7,10,10a-hexahydro-1H-pyrido[3',4':4,5]pyrrolo[1,2,3-de]quinoxaline-8(9H)-carboxylate
This compound is a crystalline solid with a molecular weight of approximately 355.44 g/mol. It has poor water solubility but is soluble in organic solvents like methanol and dimethylformamide. The compound is moderately reactive, showing some sensitivity to moisture and air. It has a melting point of around 130-132°C. Specific reactivity depends on the reaction conditions and the presence of other reagents.

About

English Name (6bR,10aS)-Ethyl 3-methyl-2,3,6b,7,10,10a-hexahydro-1H-pyrido[3',4':4,5]pyrrolo[1,2,3-de]quinoxaline-8(9H)-carboxylate
Molecular Formula C17H23N3O2
Molecular Weight 301.38 g/mol
SMILES CCOC(=O)N1CC[C@H]2[C@@H](C1)c1cccc3c1N2CCN3C
InChIKey WHCUAJCNKSIETM-KBPBESRZSA-N
Last Updated: 2025-12-31 16:27

Related Q&A

Compound Q&A

How is (6bR,10aS)-Ethyl 3-methyl-2,3,6b,7,10,10a-hexahydro-1H-pyrido[3',4':4,5]pyrrolo[1,2,3-de]quinoxaline-8(9H)-carboxylate (CAS: 313369-26-5) typically synthesized?

The compound is typically synthesized via multi-step organic synthesis routes, often involving react...

Compound Q&A

What industries use (6bR,10aS)-Ethyl 3-methyl-2,3,6b,7,10,10a-hexahydro-1H-pyrido[3',4':4,5]pyrrolo[1,2,3-de]quinoxaline-8(9H)-carboxylate (CAS: 313369-26-5)?

This compound is primarily used in the pharmaceutical industry for the development of potential drug...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...