Compound Q&A

What precautions should be taken when handling Fmoc-2,3-dehydroval-OH (CAS: 198546-38-2)?

Answer

Fmoc-2,3-dehydroval-OH
When handling Fmoc-2,3-dehydroval-OH (CAS: 198546-38-2), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or fume hood due to potential volatilization. Spills should be cleaned up with appropriate solvents, and the area should be thoroughly decontaminated. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information and emergency procedures.

About

English Name Fmoc-2,3-dehydroval-OH
Molecular Formula C20H19NO4
Molecular Weight 337.38 g/mol
SMILES CC(=C(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C
InChIKey IYVIIHAWJFLOAR-UHFFFAOYSA-N
Last Updated: 2025-12-31 16:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fmoc-2,3-dehydroval-OH (CAS: 198546-38-2)?

Fmoc-2,3-dehydroval-OH (CAS: 198546-38-2) is a white to off-white solid with a molecular weight of a...

Compound Q&A

How is Fmoc-2,3-dehydroval-OH (CAS: 198546-38-2) typically synthesized?

Fmoc-2,3-dehydroval-OH is typically synthesized via a multi-step process starting from valine. The k...

Compound Q&A

What industries use Fmoc-2,3-dehydroval-OH (CAS: 198546-38-2)?

Fmoc-2,3-dehydroval-OH (CAS: 198546-38-2) finds application in pharmaceutical industries for the syn...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...