Compound Q&A

How is Amberlite CG-50 (CAS: 9042-11-9) typically synthesized?

Answer

Amberlite CG-50
Amberlite CG-50 (CAS: 9042-11-9) is synthesized through a copolymerization process, where styrene and divinylbenzene are polymerized to form the resin. The resin is then sulfonated to introduce acidic functional groups, making it suitable for ion exchange applications.

About

CAS No 9042-11-9
English Name Amberlite CG-50
Molecular Formula C20H36O16
Molecular Weight 532.49 g/mol
SMILES COCC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)OC)CO)CO)O)O)O
InChIKey GFZFEWWPMNSVBS-UHFFFAOYSA-N
Last Updated: 2025-12-31 16:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of Amberlite CG-50 (CAS: 9042-11-9)?

Amberlite CG-50 (CAS: 9042-11-9) is a crystalline resin with a molecular weight of approximately 200...

Compound Q&A

What industries use Amberlite CG-50 (CAS: 9042-11-9)?

Amberlite CG-50 (CAS: 9042-11-9) is widely used in the pharmaceutical, polymer, and semiconductor in...

Compound Q&A

What precautions should be taken when handling Amberlite CG-50 (CAS: 9042-11-9)?

When handling Amberlite CG-50 (CAS: 9042-11-9), it is essential to wear protective gloves, goggles, ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...