Compound Q&A

What are the physical and chemical properties of (4-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-4-piperidinyl)acetic acid (CAS: 872850-31-2)?

Answer

(4-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-4-piperidinyl)acetic acid
(4-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-4-piperidinyl)acetic acid is a white crystalline solid with a molecular weight of approximately 311.42 g/mol. It is slightly soluble in water and soluble in ethanol. It shows acidity due to the carboxylic acid group, making it reactive with bases and some metal compounds. It is stable under normal storage conditions but should be protected from strong acids and oxidizers.

About

English Name (4-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-4-piperidinyl)acetic acid
Molecular Formula C13H23NO4
Molecular Weight 257.33 g/mol
SMILES CC1(CCN(CC1)C(=O)OC(C)(C)C)CC(=O)O
InChIKey ZPWNCZDQOSXJSA-UHFFFAOYSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

How is (4-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-4-piperidinyl)acetic acid (CAS: 872850-31-2) typically synthesized?

(4-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-4-piperidinyl)acetic acid can be synthesized via th...

Compound Q&A

What industries use (4-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-4-piperidinyl)acetic acid (CAS: 872850-31-2)?

(4-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-4-piperidinyl)acetic acid is primarily used in the ...

Compound Q&A

What precautions should be taken when handling (4-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-4-piperidinyl)acetic acid (CAS: 872850-31-2)?

When handling (4-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-4-piperidinyl)acetic acid, it is impo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...