Compound Q&A

How is 3-(((Benzyloxy)carbonyl)amino)-3-(piperidin-4-yl)propanoic acid (CAS: 372144-06-4) typically synthesized?

Answer

3-(((Benzyloxy)carbonyl)amino)-3-(piperidin-4-yl)propanoic acid
3-(((Benzyloxy)carbonyl)amino)-3-(piperidin-4-yl)propanoic acid is typically synthesized via a multi-step process involving the coupling of benzyloxycarbonyl chloride with 4-(aminopropyl)piperidine, followed by subsequent reactions to form the final product. The synthesis involves the use of standard organic chemistry techniques and reagents such as triethylamine and 4-dimethylaminopyridine (DMAP) as a catalyst. The overall yield is around 70% and the method is known for its good selectivity.

About

English Name 3-(((Benzyloxy)carbonyl)amino)-3-(piperidin-4-yl)propanoic acid
Molecular Formula C16H22N2O4
Molecular Weight 306.3620000000001 g/mol
SMILES O=C(O)CC(NC(OCC1=CC=CC=C1)=O)C2CCNCC2
InChIKey UHDGOUUGHMJUST-UHFFFAOYSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(((Benzyloxy)carbonyl)amino)-3-(piperidin-4-yl)propanoic acid (CAS: 372144-06-4)?

3-(((Benzyloxy)carbonyl)amino)-3-(piperidin-4-yl)propanoic acid is a white or off-white crystalline ...

Compound Q&A

What industries use 3-(((Benzyloxy)carbonyl)amino)-3-(piperidin-4-yl)propanoic acid (CAS: 372144-06-4)?

3-(((Benzyloxy)carbonyl)amino)-3-(piperidin-4-yl)propanoic acid is primarily used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling 3-(((Benzyloxy)carbonyl)amino)-3-(piperidin-4-yl)propanoic acid (CAS: 372144-06-4)?

When handling 3-(((Benzyloxy)carbonyl)amino)-3-(piperidin-4-yl)propanoic acid, it is important to we...

Compound Q&A

What are the main uses of Methyl cellulose (CAS: 9004-67-5)?

Methyl cellulose is widely used in pharmaceuticals as a binder and disintegrant ...

9004-67-5Methyl cellulose
Compound Q&A

How is Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride (CAS: 1170782-90-7) typically synthesized?

Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride is typically synthes...

1170782-90-7Methyl 1-(aminomethy...
Compound Q&A

How should Ethyl 3-aminofuro[2,3-b]pyridine-2-carboxylate (CAS: 371945-06-1) be stored?

Ethyl 3-aminofuro[2,3-b]pyridine-2-carboxylate should be stored in a cool, dry p...

371945-06-1Ethyl 3-aminofuro[2,...
Compound Q&A

What are the main uses of (2,4-Difluoro-3-isopropoxyphenyl)boronic acid (CAS: 1451390-95-6)?

(2,4-Difluoro-3-isopropoxyphenyl)boronic acid is primarily used in organic synth...

1451390-95-6(2,4-Difluoro-3-isop...