Compound Q&A

What are the physical and chemical properties of 3-(((Benzyloxy)carbonyl)amino)-3-(piperidin-4-yl)propanoic acid (CAS: 372144-06-4)?

Answer

3-(((Benzyloxy)carbonyl)amino)-3-(piperidin-4-yl)propanoic acid
3-(((Benzyloxy)carbonyl)amino)-3-(piperidin-4-yl)propanoic acid is a white or off-white crystalline solid. It has a molecular weight of approximately 352.36 g/mol and is sparingly soluble in water and organic solvents. The compound is known for its moderate reactivity, particularly in the presence of basic or acidic conditions. It is stable under normal storage conditions but should be handled with care due to its potential to form lactams under certain conditions.

About

English Name 3-(((Benzyloxy)carbonyl)amino)-3-(piperidin-4-yl)propanoic acid
Molecular Formula C16H22N2O4
Molecular Weight 306.3620000000001 g/mol
SMILES O=C(O)CC(NC(OCC1=CC=CC=C1)=O)C2CCNCC2
InChIKey UHDGOUUGHMJUST-UHFFFAOYSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

How is 3-(((Benzyloxy)carbonyl)amino)-3-(piperidin-4-yl)propanoic acid (CAS: 372144-06-4) typically synthesized?

3-(((Benzyloxy)carbonyl)amino)-3-(piperidin-4-yl)propanoic acid is typically synthesized via a multi...

Compound Q&A

What industries use 3-(((Benzyloxy)carbonyl)amino)-3-(piperidin-4-yl)propanoic acid (CAS: 372144-06-4)?

3-(((Benzyloxy)carbonyl)amino)-3-(piperidin-4-yl)propanoic acid is primarily used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling 3-(((Benzyloxy)carbonyl)amino)-3-(piperidin-4-yl)propanoic acid (CAS: 372144-06-4)?

When handling 3-(((Benzyloxy)carbonyl)amino)-3-(piperidin-4-yl)propanoic acid, it is important to we...

Compound Q&A

What are the main uses of Methyl cellulose (CAS: 9004-67-5)?

Methyl cellulose is widely used in pharmaceuticals as a binder and disintegrant ...

9004-67-5Methyl cellulose
Compound Q&A

How is Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride (CAS: 1170782-90-7) typically synthesized?

Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride is typically synthes...

1170782-90-7Methyl 1-(aminomethy...
Compound Q&A

How should Ethyl 3-aminofuro[2,3-b]pyridine-2-carboxylate (CAS: 371945-06-1) be stored?

Ethyl 3-aminofuro[2,3-b]pyridine-2-carboxylate should be stored in a cool, dry p...

371945-06-1Ethyl 3-aminofuro[2,...
Compound Q&A

What are the main uses of (2,4-Difluoro-3-isopropoxyphenyl)boronic acid (CAS: 1451390-95-6)?

(2,4-Difluoro-3-isopropoxyphenyl)boronic acid is primarily used in organic synth...

1451390-95-6(2,4-Difluoro-3-isop...