Compound Q&A

What are the physical and chemical properties of Dibenzofuran-3-ol (CAS: 20279-16-7)?

Answer

Dibenzofuran-3-ol
Dibenzofuran-3-ol (CAS: 20279-16-7) is a crystalline solid with a molecular weight of approximately 216.20 g/mol. It has a low solubility in water but is more soluble in organic solvents such as ethanol and dichloromethane. Chemically, it is relatively stable but can react with strong acids or bases. It is often used in organic synthesis and has a characteristic molecular structure that makes it suitable for various applications.

About

CAS No 20279-16-7
English Name Dibenzofuran-3-ol
Molecular Formula C12H8O2
Molecular Weight 184.19 g/mol
SMILES C1=CC=C2C(=C1)C3=C(O2)C=C(C=C3)O
InChIKey GOQIZPVZGYUGIA-UHFFFAOYSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

How is Dibenzofuran-3-ol (CAS: 20279-16-7) typically synthesized?

Dibenzofuran-3-ol (CAS: 20279-16-7) can be synthesized through various routes, commonly using reduct...

Compound Q&A

What industries use Dibenzofuran-3-ol (CAS: 20279-16-7)?

Dibenzofuran-3-ol (CAS: 20279-16-7) is primarily used in pharmaceuticals, where it serves as a precu...

Compound Q&A

What precautions should be taken when handling Dibenzofuran-3-ol (CAS: 20279-16-7)?

When handling Dibenzofuran-3-ol (CAS: 20279-16-7), it is important to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...