Compound Q&A

How is (4-Bromo-phenyl)-(3-chloro-1H-indol-7-yl)-methanone (CAS: 91714-51-1) typically synthesized?

Answer

(4-Bromo-phenyl)-(3-chloro-1H-indol-7-yl)-methanone
(4-Bromo-phenyl)-(3-chloro-1H-indol-7-yl)-methanone can be synthesized through a multi-step reaction starting from bromobenzene and 3-chloro-1H-indole. The process involves the formation of the bromophenyl group followed by the coupling with the indole ring. Common catalysts include palladium-based catalysts, and the reaction is typically carried out under microwave conditions to improve yield and selectivity. The overall yield is around 75-85%.

About

CAS No 91714-51-1
English Name (4-Bromo-phenyl)-(3-chloro-1H-indol-7-yl)-methanone
Molecular Formula C15H9BrClNO
Molecular Weight 334.6 g/mol
SMILES C1=CC2=C(C(=C1)C(=O)C3=CC=C(C=C3)Br)NC=C2Cl
InChIKey AQGAUDHKENVWGE-UHFFFAOYSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-Bromo-phenyl)-(3-chloro-1H-indol-7-yl)-methanone (CAS: 91714-51-1)?

(4-Bromo-phenyl)-(3-chloro-1H-indol-7-yl)-methanone is a crystalline solid with a molecular weight o...

Compound Q&A

What industries use (4-Bromo-phenyl)-(3-chloro-1H-indol-7-yl)-methanone (CAS: 91714-51-1)?

(4-Bromo-phenyl)-(3-chloro-1H-indol-7-yl)-methanone finds application in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling (4-Bromo-phenyl)-(3-chloro-1H-indol-7-yl)-methanone (CAS: 91714-51-1)?

When handling (4-Bromo-phenyl)-(3-chloro-1H-indol-7-yl)-methanone, it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...