Compound Q&A

What industries use 4-tert-Amyl-2-amino-6-nitrophenol (CAS: 83488-02-2)?

Answer

4-tert-Amyl-2-amino-6-nitrophenol
4-tert-Amyl-2-amino-6-nitrophenol (CAS: 83488-02-2) is primarily used in the pharmaceutical and dye industries. It serves as a precursor in the synthesis of various dyes and has applications in the development of new pharmaceutical compounds. Additionally, it can be used in the production of sensors and as a reagent in organic synthesis due to its nitro and amino functionalities.

About

CAS No 83488-02-2
English Name 4-tert-Amyl-2-amino-6-nitrophenol
Molecular Formula C11H16N2O3
Molecular Weight 224.26 g/mol
SMILES CCC(C)(C)C1=CC(=C(C(=C1)[N+](=O)[O-])O)N
InChIKey WLJLENRIPLYJSZ-UHFFFAOYSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-tert-Amyl-2-amino-6-nitrophenol (CAS: 83488-02-2)?

4-tert-Amyl-2-amino-6-nitrophenol (CAS: 83488-02-2) is a crystalline solid with a molecular weight o...

Compound Q&A

How is 4-tert-Amyl-2-amino-6-nitrophenol (CAS: 83488-02-2) typically synthesized?

4-tert-Amyl-2-amino-6-nitrophenol (CAS: 83488-02-2) is typically synthesized via the reaction of 4-t...

Compound Q&A

What precautions should be taken when handling 4-tert-Amyl-2-amino-6-nitrophenol (CAS: 83488-02-2)?

When handling 4-tert-Amyl-2-amino-6-nitrophenol (CAS: 83488-02-2), it is important to use appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...