Compound Q&A

What are the physical and chemical properties of [1-({6-[(6-Aminohexyl)amino]hexyl}amino)-1,5-pentanediyl]bis(phosphonic acid) (CAS: 35657-77-3)?

Answer

[1-({6-[(6-Aminohexyl)amino]hexyl}amino)-1,5-pentanediyl]bis(phosphonic acid)
The compound is a white crystalline solid with a molecular weight of approximately 452.46 g/mol. It has a low solubility in water but can dissolve in organic solvents. The compound is known for its reactivity, particularly in forming stable complexes with metal ions and its use in chelating agents. It exhibits poor thermal stability and may decompose at higher temperatures.

About

CAS No 35657-77-3
English Name [1-({6-[(6-Aminohexyl)amino]hexyl}amino)-1,5-pentanediyl]bis(phosphonic acid)
Molecular Formula C17H41N3O6P2
Molecular Weight 445.48 g/mol
SMILES C(CCCN(CP(=O)(O)O)CP(=O)(O)O)CCN(CCCCCCN(CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O
InChIKey MNUUYROWAVOQRI-UHFFFAOYSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

How is [1-({6-[(6-Aminohexyl)amino]hexyl}amino)-1,5-pentanediyl]bis(phosphonic acid) (CAS: 35657-77-3) typically synthesized?

The compound is synthesized through multi-step chemical reactions, starting from hexanediamine and 6...

Compound Q&A

What industries use [1-({6-[(6-Aminohexyl)amino]hexyl}amino)-1,5-pentanediyl]bis(phosphonic acid) (CAS: 35657-77-3)?

This compound is used in various industries, including pharmaceuticals for drug delivery systems and...

Compound Q&A

What precautions should be taken when handling [1-({6-[(6-Aminohexyl)amino]hexyl}amino)-1,5-pentanediyl]bis(phosphonic acid) (CAS: 35657-77-3)?

Proper personal protective equipment (PPE) should be worn, including gloves, goggles, and a lab coat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...