Compound Q&A

What are the physical and chemical properties of [4-[2-(Diethylamino)ethoxy]-3,5-diiodophenyl][2-(1-methoxybutyl)-1-benzofuran-3-yl]methanone (CAS: 1087223-70-8)?

Answer

{4-[2-(Diethylamino)ethoxy]-3,5-diiodophenyl}[2-(1-methoxybutyl)-1-benzofuran-3-yl]methanone
This compound is a crystalline solid with a high molecular weight due to its iodine content. It has low water solubility but good solubility in organic solvents like DMSO. Chemically, it is highly reactive, with potential for iodine substitution reactions. Its reactivity can be influenced by its complex molecular structure.

About

English Name {4-[2-(Diethylamino)ethoxy]-3,5-diiodophenyl}[2-(1-methoxybutyl)-1-benzofuran-3-yl]methanone
Molecular Formula C26H31I2NO4
Molecular Weight 675.34 g/mol
SMILES CCCC(c1oc2c(c1C(=O)c1cc(I)c(c(c1)I)OCCN(CC)CC)cccc2)OC
InChIKey QDIGHYCNRQYPFR-UHFFFAOYSA-N
Last Updated: 2025-12-31 06:49

Related Q&A

Compound Q&A

How is [4-[2-(Diethylamino)ethoxy]-3,5-diiodophenyl][2-(1-methoxybutyl)-1-benzofuran-3-yl]methanone (CAS: 1087223-70-8) typically synthesized?

This compound is often synthesized through a multi-step process involving iodination of a precursor ...

Compound Q&A

What industries use [4-[2-(Diethylamino)ethoxy]-3,5-diiodophenyl][2-(1-methoxybutyl)-1-benzofuran-3-yl]methanone (CAS: 1087223-70-8)?

This compound is primarily used in the pharmaceutical industry for its potential as a molecular prob...

Compound Q&A

What precautions should be taken when handling [4-[2-(Diethylamino)ethoxy]-3,5-diiodophenyl][2-(1-methoxybutyl)-1-benzofuran-3-yl]methanone (CAS: 1087223-70-8)?

When handling this compound, appropriate personal protective equipment (PPE) such as gloves, goggles...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...