Compound Q&A

What industries use 4-Carboxyphenylalanine (CAS: 22976-70-1)?

Answer

4-Carboxyphenylalanine
4-Carboxyphenylalanine is primarily used in the pharmaceutical industry for the development of novel drugs and as an intermediate in the synthesis of other compounds. It also finds applications in the polymer industry as a monomer for the synthesis of biodegradable polymers. Additionally, it is utilized in the production of sensors for detecting various biological and chemical agents, and in semiconductor technology for use in organic photovoltaic materials.

About

CAS No 22976-70-1
English Name 4-Carboxyphenylalanine
Molecular Formula C10H11NO4
Molecular Weight 209.2 g/mol
SMILES C1=CC(=CC=C1CC(C(=O)O)N)C(=O)O
InChIKey YXDGRBPZVQPESQ-UHFFFAOYSA-N
Last Updated: 2025-12-31 06:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Carboxyphenylalanine (CAS: 22976-70-1)?

4-Carboxyphenylalanine is a white crystalline solid with a molecular weight of approximately 207.15 ...

Compound Q&A

How is 4-Carboxyphenylalanine (CAS: 22976-70-1) typically synthesized?

4-Carboxyphenylalanine can be synthesized via the condensation reaction of 4-carboxybenzaldehyde and...

Compound Q&A

What precautions should be taken when handling 4-Carboxyphenylalanine (CAS: 22976-70-1)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a laboratory coat should be ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...