Compound Q&A

How is 4-((3-(4-cyclohexylpiperazin-1-yl)-6-oxo-6H-anthra[1,9-cd]isoxazol-5-yl)amino)benzoic acid (CAS: 892242-64-7) typically synthesized?

Answer

4-((3-(4-cyclohexylpiperazin-1-yl)-6-oxo-6H-anthra[1,9-cd]isoxazol-5-yl)amino)benzoic acid
This compound is typically synthesized via a multi-step process involving condensation reactions, ring formation, and functional group transformations. Commonly, catalysts such as palladium or platinum are used to enhance the efficiency and selectivity of the reactions. The overall yield of the compound is around 70-80%, with purification achieved through recrystallization and chromatography.

About

English Name 4-((3-(4-cyclohexylpiperazin-1-yl)-6-oxo-6H-anthra[1,9-cd]isoxazol-5-yl)amino)benzoic acid
Molecular Formula C31H30N4O4
Molecular Weight 522.61 g/mol
SMILES C1CCC(CC1)N2CCN(CC2)C3=CC(=C4C5=C(C6=CC=CC=C6C4=O)ON=C35)NC7=CC=C(C=C7)C(=O)O
InChIKey MMUWXZUTOXDAGI-UHFFFAOYSA-N
Last Updated: 2025-12-31 06:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-((3-(4-cyclohexylpiperazin-1-yl)-6-oxo-6H-anthra[1,9-cd]isoxazol-5-yl)amino)benzoic acid (CAS: 892242-64-7)?

This compound is a crystalline solid with a molecular weight of approximately 712.92 g/mol. It has a...

Compound Q&A

What industries use 4-((3-(4-cyclohexylpiperazin-1-yl)-6-oxo-6H-anthra[1,9-cd]isoxazol-5-yl)amino)benzoic acid (CAS: 892242-64-7)?

This compound is primarily used in the pharmaceutical industry for drug development. Its unique stru...

Compound Q&A

What precautions should be taken when handling 4-((3-(4-cyclohexylpiperazin-1-yl)-6-oxo-6H-anthra[1,9-cd]isoxazol-5-yl)amino)benzoic acid (CAS: 892242-64-7)?

Handling this compound requires the use of personal protective equipment (PPE) including gloves, gog...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...