Compound Q&A

How should 1-(4-Hydroxy-3-methoxyphenyl)-3-(4-methylphenyl)acetone (CAS: 134612-39-8) be stored?

Answer

1-(4-Hydroxy-3-methoxyphenyl)-3-(4-methylphenyl)acetone
1-(4-Hydroxy-3-methoxyphenyl)-3-(4-methylphenyl)acetone (CAS: 134612-39-8) should be stored in a cool, dark place, away from direct sunlight and heat sources. Use a tightly sealed container to prevent evaporation and contamination. Store it in a well-ventilated area to minimize the risk of fire and ensure proper air circulation. Avoid storing it near flammable materials.

About

English Name 1-(4-Hydroxy-3-methoxyphenyl)-3-(4-methylphenyl)acetone
Molecular Formula C17H18O3
Molecular Weight 270.33 g/mol
SMILES Cc1ccc(cc1)CC(=O)Cc2ccc(c(c2)OC)O
InChIKey QEPACEPVBVKWSW-UHFFFAOYSA-N
Last Updated: 2025-12-31 02:27

Related Q&A

Compound Q&A

What is 1-(4-Hydroxy-3-methoxyphenyl)-3-(4-methylphenyl)acetone (CAS: 134612-39-8)?

1-(4-Hydroxy-3-methoxyphenyl)-3-(4-methylphenyl)acetone (CAS: 134612-39-8) is a colorless to yellowi...

Compound Q&A

What are the main uses of 1-(4-Hydroxy-3-methoxyphenyl)-3-(4-methylphenyl)acetone (CAS: 134612-39-8)?

1-(4-Hydroxy-3-methoxyphenyl)-3-(4-methylphenyl)acetone (CAS: 134612-39-8) is primarily used as a ra...

Compound Q&A

Is 1-(4-Hydroxy-3-methoxyphenyl)-3-(4-methylphenyl)acetone (CAS: 134612-39-8) safe?

1-(4-Hydroxy-3-methoxyphenyl)-3-(4-methylphenyl)acetone (CAS: 134612-39-8) is generally considered s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...