Compound Q&A

What is (S)-Tedizolid (CAS: 1431699-67-0)?

Answer

(S)-Tedizolid
(S)-Tedizolid (CAS: 1431699-67-0) is an antibiotic used for the treatment of skin infections caused by certain bacteria. It has a chemical structure that allows it to effectively penetrate bacterial cell walls and disrupt their function.

About

English Name (S)-Tedizolid
Molecular Formula C17H15FN6O3
Molecular Weight 370.3440000000001 g/mol
SMILES OCC1OC(=O)N(C1)c1ccc(c(c1)F)c1ccc(nc1)c1nnn(n1)C
InChIKey XFALPSLJIHVRKE-LBPRGKRZSA-N
Last Updated: 2025-12-31 02:27

Related Q&A

Compound Q&A

What are the main uses of (S)-Tedizolid (CAS: 1431699-67-0)?

(S)-Tedizolid (CAS: 1431699-67-0) is primarily used to treat skin infections such as those caused by...

Compound Q&A

Is (S)-Tedizolid (CAS: 1431699-67-0) safe?

Yes, (S)-Tedizolid (CAS: 1431699-67-0) is generally considered safe when used as directed. However, ...

Compound Q&A

How should (S)-Tedizolid (CAS: 1431699-67-0) be stored?

(S)-Tedizolid (CAS: 1431699-67-0) should be stored at room temperature between 15-30°C (59-86°F) and...

Compound Q&A

Is 4-Anilino-1H-1,2,3-triazole-5-carboxylic acid (CAS: 72693-60-8) safe?

4-Anilino-1H-1,2,3-triazole-5-carboxylic acid is generally considered safe when ...

72693-60-84-Anilino-1H-1,2,3-t...
Compound Q&A

How should waste containing 2-(2-Aminoethyl)-1H-benzimidazol-4-ol (CAS: 933697-27-9) be handled?

Waste containing 2-(2-Aminoethyl)-1H-benzimidazol-4-ol (CAS: 933697-27-9) should...

933697-27-92-(2-Aminoethyl)-1H-...
Compound Q&A

How is 4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-hydroxybenzamide hydrochloride (CAS: 38059-78-8) typically synthesized?

4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-hydroxybenzamide hydrochloride is t...

38059-78-84-Amino-5-chloro-N-[...
Compound Q&A

What are the main uses of 2-(4-Bromophenyl)-1-(2,4-dihydroxyphenyl)ethanone (CAS: 92152-60-8)?

2-(4-Bromophenyl)-1-(2,4-dihydroxyphenyl)ethanone (CAS: 92152-60-8) is primarily...

92152-60-82-(4-Bromophenyl)-1-...