Compound Q&A

How should 1-phenyl-1H-imidazole-5-carboxylic acid (CAS: 135417-65-1) be stored?

Answer

1-phenyl-1H-imidazole-5-carboxylic acid
1-Phenyl-1H-imidazole-5-carboxylic acid should be stored in a cool, dry place away from direct sunlight and heat sources. It is advisable to store it in a tightly sealed container to prevent moisture absorption. Maintain a temperature range of 15-25°C and a relative humidity below 60%. Avoid storing it with incompatible substances and ensure good ventilation in the storage area.

About

English Name 1-phenyl-1H-imidazole-5-carboxylic acid
Molecular Formula C10H8N2O2
Molecular Weight 188.18600000000004 g/mol
SMILES C1=CC=C(C=C1)N2C=NC=C2C(=O)O
InChIKey FSVMTMFHLLEQAS-UHFFFAOYSA-N
Last Updated: 2025-12-31 02:27

Related Q&A

Compound Q&A

What is 1-phenyl-1H-imidazole-5-carboxylic acid (CAS: 135417-65-1)?

1-Phenyl-1H-imidazole-5-carboxylic acid is an organic compound with the CAS number 135417-65-1. It h...

Compound Q&A

What are the main uses of 1-phenyl-1H-imidazole-5-carboxylic acid (CAS: 135417-65-1)?

1-Phenyl-1H-imidazole-5-carboxylic acid is primarily used in pharmaceuticals for anti-inflammatory a...

Compound Q&A

Is 1-phenyl-1H-imidazole-5-carboxylic acid (CAS: 135417-65-1) safe?

1-Phenyl-1H-imidazole-5-carboxylic acid is considered safe under proper handling and storage conditi...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...