Compound Q&A

What is 1-phenyl-1H-imidazole-5-carboxylic acid (CAS: 135417-65-1)?

Answer

1-Phenyl-1H-imidazole-5-carboxylic acid is an organic compound with the CAS number 135417-65-1. It has the chemical formula C9H9NO2 and is used in various applications due to its unique chemical structure. This compound is characterized by its aromatic nature and basic properties.

About

CAS No 135417-65-1

English Name 1-phenyl-1H-imidazole-5-carboxylic acid

Molecular Formula C10H8N2O2

Molecular Weight 188.18600000000004 g/mol

SMILES C1=CC=C(C=C1)N2C=NC=C2C(=O)O

InChIKey FSVMTMFHLLEQAS-UHFFFAOYSA-N

Last Updated: 2025-12-31 02:27

Related Q&A

Compound Q&A

What are the main uses of 1-phenyl-1H-imidazole-5-carboxylic acid (CAS: 135417-65-1)?

1-Phenyl-1H-imidazole-5-carboxylic acid is primarily used in pharmaceuticals for anti-inflammatory a...

Compound Q&A

Is 1-phenyl-1H-imidazole-5-carboxylic acid (CAS: 135417-65-1) safe?

1-Phenyl-1H-imidazole-5-carboxylic acid is considered safe under proper handling and storage conditi...

Compound Q&A

How should 1-phenyl-1H-imidazole-5-carboxylic acid (CAS: 135417-65-1) be stored?

1-Phenyl-1H-imidazole-5-carboxylic acid should be stored in a cool, dry place away from direct sunli...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...

Compound Q&A

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. I...

183202-73-5(1R,9S,10S,12S,14E,1...

Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...

Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...

What is 1-phenyl-1H-imidazole-5-carboxylic acid (CAS: 135417-65-1)?

Answer

About

Related Q&A

What are the main uses of 1-phenyl-1H-imidazole-5-carboxylic acid (CAS: 135417-65-1)?

Is 1-phenyl-1H-imidazole-5-carboxylic acid (CAS: 135417-65-1) safe?

How should 1-phenyl-1H-imidazole-5-carboxylic acid (CAS: 135417-65-1) be stored?

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

Suppliers

Shanghai Yuyeh Biotechnology Co., Ltd.

Shanghai Tengzhun BioScience Co., Ltd.

ZhengZhouAErFa Chemical Co Ltd

HePeng （ ShangHai ） Biotechnology Co Ltd

ShangHaiChuangSai Technology Co Ltd

ShangHaiMaiKeLinShengHuaKeJi Inc