Compound Q&A

How should 6-(3-Cyanophenyl)nicotinic acid (CAS: 887975-97-5) be stored?

Answer

6-(3-Cyanophenyl)nicotinic acid
6-(3-Cyanophenyl)nicotinic acid should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent degradation. Proper storage conditions are essential to maintain the compound's stability and prevent chemical reactions that could alter its properties.

About

English Name 6-(3-Cyanophenyl)nicotinic acid
Molecular Formula C13H8N2O2
Molecular Weight 213.24 g/mol
SMILES C1=CC(=CC(=C1)C2=NC=C(C=C2)C(=O)O)C#N
InChIKey GKSSIPVARYBMTM-UHFFFAOYSA-N
Last Updated: 2025-12-31 02:27

Related Q&A

Compound Q&A

What is 6-(3-Cyanophenyl)nicotinic acid (CAS: 887975-97-5)?

6-(3-Cyanophenyl)nicotinic acid, also known as 3-cyanophenyl nicotinate, is a derivative of nicotini...

Compound Q&A

What are the main uses of 6-(3-Cyanophenyl)nicotinic acid (CAS: 887975-97-5)?

6-(3-Cyanophenyl)nicotinic acid is primarily used in pharmaceutical research as a potential drug can...

Compound Q&A

Is 6-(3-Cyanophenyl)nicotinic acid (CAS: 887975-97-5) safe?

6-(3-Cyanophenyl)nicotinic acid is generally considered safe when handled with appropriate precautio...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...